C19H24O2 — CID 137367516
4-methyl-4-(2-pentylphenyl)cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 137367516) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-methyl-4-(2-pentylphenyl)cyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 4-methyl-4-(2-pentylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 137367516 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 4-methyl-4-(2-pentylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCCCCc1ccccc1C1(C)C=CC(C(=O)O)C=C1 |
| InChI | InChI=1S/C19H24O2/c1-3-4-5-8-15-9-6-7-10-17(15)19(2)13-11-16(12-14-19)18(20)21/h6-7,9-14,16H,3-5,8H2,1-2H3,(H,20,21) |
| InChIKey | OTCJCPZGNLCHQY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|