C25H36O2 — CID 137367486
4-heptyl-4-[2-(2-methylbutyl)phenyl]cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 137367486) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is 4-heptyl-4-[2-(2-methylbutyl)phenyl]cyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 4-heptyl-4-[2-(2-methylbutyl)phenyl]cyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 137367486 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 4-heptyl-4-[2-(2-methylbutyl)phenyl]cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCCCCCCC1(c2ccccc2CC(C)CC)C=CC(C(=O)O)C=C1 |
| InChI | InChI=1S/C25H36O2/c1-4-6-7-8-11-16-25(17-14-21(15-18-25)24(26)27)23-13-10-9-12-22(23)19-20(3)5-2/h9-10,12-15,17-18,20-21H,4-8,11,16,19H2,1-3H3,(H,26,27) |
| InChIKey | NPLWXCPUVGBCSC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|