C25H35BF2O4 — CID 67784502
[1,2-difluoro-3-(5-nonyl-1,3-dioxan-2-yl)-6-phenylcyclohexa-2,4-dien-1-yl]boronic acid (PubChem CID 67784502) has the molecular formula C25H35BF2O4 and a molecular weight of 448.36 g/mol. Its IUPAC name is [1,2-difluoro-3-(5-nonyl-1,3-dioxan-2-yl)-6-phenylcyclohexa-2,4-dien-1-yl]boronic acid.
| Compound Name | [1,2-difluoro-3-(5-nonyl-1,3-dioxan-2-yl)-6-phenylcyclohexa-2,4-dien-1-yl]boronic acid |
|---|---|
| PubChem CID | 67784502 |
| Molecular Formula | C25H35BF2O4 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | [1,2-difluoro-3-(5-nonyl-1,3-dioxan-2-yl)-6-phenylcyclohexa-2,4-dien-1-yl]boronic acid |
| SMILES | CCCCCCCCCC1COC(C2=C(F)C(F)(B(O)O)C(c3ccccc3)C=C2)OC1 |
| InChI | InChI=1S/C25H35BF2O4/c1-2-3-4-5-6-7-9-12-19-17-31-24(32-18-19)21-15-16-22(20-13-10-8-11-14-20)25(28,23(21)27)26(29)30/h8,10-11,13-16,19,22,24,29-30H,2-7,9,12,17-18H2,1H3 |
| InChIKey | YMXIVAGEFBHQRK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|