C27H38O4 — CID 57212078
4-[4-[(2R,5S)-5-octoxyhexan-2-yl]oxyphenyl]benzoic acid (PubChem CID 57212078) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is 4-[4-[(2R,5S)-5-octoxyhexan-2-yl]oxyphenyl]benzoic acid.
| Compound Name | 4-[4-[(2R,5S)-5-octoxyhexan-2-yl]oxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 57212078 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 4-[4-[(2R,5S)-5-octoxyhexan-2-yl]oxyphenyl]benzoic acid |
| SMILES | CCCCCCCCO[C@@H](C)CC[C@@H](C)Oc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H38O4/c1-4-5-6-7-8-9-20-30-21(2)10-11-22(3)31-26-18-16-24(17-19-26)23-12-14-25(15-13-23)27(28)29/h12-19,21-22H,4-11,20H2,1-3H3,(H,28,29)/t21-,22+/m0/s1 |
| InChIKey | NDQJHNLZBBRPEJ-FCHUYYIVSA-N |
| XLogP | 7.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|