C19H24O — CID 175608884
1-(1-benzylcyclohexa-2,4-dien-1-yl)hexan-1-one (PubChem CID 175608884) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-(1-benzylcyclohexa-2,4-dien-1-yl)hexan-1-one.
| Compound Name | 1-(1-benzylcyclohexa-2,4-dien-1-yl)hexan-1-one |
|---|---|
| PubChem CID | 175608884 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-(1-benzylcyclohexa-2,4-dien-1-yl)hexan-1-one |
| SMILES | CCCCCC(=O)C1(Cc2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C19H24O/c1-2-3-6-13-18(20)19(14-9-5-10-15-19)16-17-11-7-4-8-12-17/h4-5,7-12,14H,2-3,6,13,15-16H2,1H3 |
| InChIKey | NKVGOZGREWFCDZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|