About benzyl(trimethyl)azanium;hexanoic acid
benzyl(trimethyl)azanium;hexanoic acid (PubChem CID 71445176) has the molecular formula C16H28NO2+
and a molecular weight of 266.40 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;hexanoic acid.
Molecular Properties
| Compound Name | benzyl(trimethyl)azanium;hexanoic acid |
| PubChem CID | 71445176 |
| Molecular Formula | C16H28NO2+ |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | benzyl(trimethyl)azanium;hexanoic acid |
| SMILES | CCCCCC(=O)O.C[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H16N.C6H12O2/c1-11(2,3)9-10-7-5-4-6-8-10;1-2-3-4-5-6(7)8/h4-8H,9H2,1-3H3;2-5H2,1H3,(H,7,8)/q+1; |
| InChIKey | YTHBNWUJUPLAFV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(trimethyl)azanium;hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(trimethyl)azanium;hexanoic acid?
The IUPAC name of benzyl(trimethyl)azanium;hexanoic acid (CID 71445176) is benzyl(trimethyl)azanium;hexanoic acid.
What is the SMILES notation for benzyl(trimethyl)azanium;hexanoic acid?
The canonical SMILES for benzyl(trimethyl)azanium;hexanoic acid is CCCCCC(=O)O.C[N+](C)(C)Cc1ccccc1.
What is the InChIKey of benzyl(trimethyl)azanium;hexanoic acid?
The InChIKey is YTHBNWUJUPLAFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N.C6H12O2/c1-11(2,3)9-10-7-5-4-6-8-10;1-2-3-4-5-6(7)8/h4-8H,9H2,1-3H3;2-5H2,1H3,(H,7,8)/q+1;.
What are the key properties of benzyl(trimethyl)azanium;hexanoic acid?
benzyl(trimethyl)azanium;hexanoic acid has a molecular weight of 266.40 g/mol, XLogP of 3.54, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(trimethyl)azanium;hexanoic acid is sourced from PubChem (CID 71445176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).