C10H17O3P — CID 150403255
(1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid (PubChem CID 150403255) has the molecular formula C10H17O3P and a molecular weight of 216.22 g/mol. Its IUPAC name is (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid.
| Compound Name | (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid |
|---|---|
| PubChem CID | 150403255 |
| Molecular Formula | C10H17O3P |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid |
| SMILES | CCCCC1(P(=O)(O)O)C=CC=CC1 |
| InChI | InChI=1S/C10H17O3P/c1-2-3-7-10(14(11,12)13)8-5-4-6-9-10/h4-6,8H,2-3,7,9H2,1H3,(H2,11,12,13) |
| InChIKey | HEFHZFDMDNWOSE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|