(1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid

C10H17O3P — CID 150403255

IUPAC(1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid
SMILESCCCCC1(P(=O)(O)O)C=CC=CC1
InChIInChI=1S/C10H17O3P/c1-2-3-7-10(14(11,12)13)8-5-4-6-9-10/h4-6,8H,2-3,7,9H2,1H3,(H2,11,12,13)
InChIKeyHEFHZFDMDNWOSE-UHFFFAOYSA-N
MW216.22 g/mol
LogP2.61
Rot. Bonds4

About (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid

(1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid (PubChem CID 150403255) has the molecular formula C10H17O3P and a molecular weight of 216.22 g/mol. Its IUPAC name is (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid.

Molecular Properties

Compound Name(1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid
PubChem CID150403255
Molecular FormulaC10H17O3P
Molecular Weight216.22 g/mol
Exact Mass216.09
IUPAC Name(1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid
SMILESCCCCC1(P(=O)(O)O)C=CC=CC1
InChIInChI=1S/C10H17O3P/c1-2-3-7-10(14(11,12)13)8-5-4-6-9-10/h4-6,8H,2-3,7,9H2,1H3,(H2,11,12,13)
InChIKeyHEFHZFDMDNWOSE-UHFFFAOYSA-N
XLogP2.61
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.22
LogP ≤ 52.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid?
The IUPAC name of (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid (CID 150403255) is (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid.
What is the SMILES notation for (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid?
The canonical SMILES for (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid is CCCCC1(P(=O)(O)O)C=CC=CC1.
What is the InChIKey of (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid?
The InChIKey is HEFHZFDMDNWOSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17O3P/c1-2-3-7-10(14(11,12)13)8-5-4-6-9-10/h4-6,8H,2-3,7,9H2,1H3,(H2,11,12,13).
What are the key properties of (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid?
(1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid has a molecular weight of 216.22 g/mol, XLogP of 2.61, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-butylcyclohexa-2,4-dien-1-yl)phosphonic acid is sourced from PubChem (CID 150403255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).