C10H14O — CID 151533761
2-(1-ethenylcyclohexa-2,4-dien-1-yl)ethanol (PubChem CID 151533761) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-(1-ethenylcyclohexa-2,4-dien-1-yl)ethanol.
| Compound Name | 2-(1-ethenylcyclohexa-2,4-dien-1-yl)ethanol |
|---|---|
| PubChem CID | 151533761 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-(1-ethenylcyclohexa-2,4-dien-1-yl)ethanol |
| SMILES | C=CC1(CCO)C=CC=CC1 |
| InChI | InChI=1S/C10H14O/c1-2-10(8-9-11)6-4-3-5-7-10/h2-6,11H,1,7-9H2 |
| InChIKey | PXAIPHDEGCOHHZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|