C13H20O2 — CID 22590644
5-cyclohexyl-5-(hydroperoxymethyl)cyclohexa-1,3-diene (PubChem CID 22590644) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-cyclohexyl-5-(hydroperoxymethyl)cyclohexa-1,3-diene.
| Compound Name | 5-cyclohexyl-5-(hydroperoxymethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 22590644 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 5-cyclohexyl-5-(hydroperoxymethyl)cyclohexa-1,3-diene |
| SMILES | OOCC1(C2CCCCC2)C=CC=CC1 |
| InChI | InChI=1S/C13H20O2/c14-15-11-13(9-5-2-6-10-13)12-7-3-1-4-8-12/h2,5-6,9,12,14H,1,3-4,7-8,10-11H2 |
| InChIKey | OKJZNULVXAMOAU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|