C17H28 — CID 173011967
3-cyclohexyl-3-pentylcyclohexa-1,4-diene (PubChem CID 173011967) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 3-cyclohexyl-3-pentylcyclohexa-1,4-diene.
| Compound Name | 3-cyclohexyl-3-pentylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 173011967 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 3-cyclohexyl-3-pentylcyclohexa-1,4-diene |
| SMILES | CCCCCC1(C2CCCCC2)C=CCC=C1 |
| InChI | InChI=1S/C17H28/c1-2-3-8-13-17(14-9-5-10-15-17)16-11-6-4-7-12-16/h9-10,14-16H,2-8,11-13H2,1H3 |
| InChIKey | OFHVXZKJZFXQMD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|