C18H28O — CID 87124439
4-cyclohexyl-4-pentylcyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 87124439) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is 4-cyclohexyl-4-pentylcyclohexa-1,5-diene-1-carbaldehyde.
| Compound Name | 4-cyclohexyl-4-pentylcyclohexa-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 87124439 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 4-cyclohexyl-4-pentylcyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | CCCCCC1(C2CCCCC2)C=CC(C=O)=CC1 |
| InChI | InChI=1S/C18H28O/c1-2-3-7-12-18(17-8-5-4-6-9-17)13-10-16(15-19)11-14-18/h10-11,13,15,17H,2-9,12,14H2,1H3 |
| InChIKey | CECUYQYAGYVVBE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|