C27H38FeO-6 — CID 174758031
3-cyclohexyl-2-cyclopenta-2,4-dien-1-yl-3-pentylcyclohexan-1-one;cyclopentane;iron (PubChem CID 174758031) has the molecular formula C27H38FeO-6 and a molecular weight of 434.45 g/mol. Its IUPAC name is 3-cyclohexyl-2-cyclopenta-2,4-dien-1-yl-3-pentylcyclohexan-1-one;cyclopentane;iron.
| Compound Name | 3-cyclohexyl-2-cyclopenta-2,4-dien-1-yl-3-pentylcyclohexan-1-one;cyclopentane;iron |
|---|---|
| PubChem CID | 174758031 |
| Molecular Formula | C27H38FeO-6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 3-cyclohexyl-2-cyclopenta-2,4-dien-1-yl-3-pentylcyclohexan-1-one;cyclopentane;iron |
| SMILES | CCCCCC1(C2CCCCC2)CCCC(=O)C1[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C22H33O.C5H5.Fe/c1-2-3-9-16-22(19-13-5-4-6-14-19)17-10-15-20(23)21(22)18-11-7-8-12-18;1-2-4-5-3-1;/h7-8,11-12,19,21H,2-6,9-10,13-17H2,1H3;1-5H;/q-1;-5; |
| InChIKey | DDKMBVUWIHPPCR-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|