C18H30O — CID 102512466
6-methyl-4,6-dipentylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 102512466) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 6-methyl-4,6-dipentylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 6-methyl-4,6-dipentylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 102512466 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 6-methyl-4,6-dipentylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CCCCCC1=CC=C(C=O)C(C)(CCCCC)C1 |
| InChI | InChI=1S/C18H30O/c1-4-6-8-10-16-11-12-17(15-19)18(3,14-16)13-9-7-5-2/h11-12,15H,4-10,13-14H2,1-3H3 |
| InChIKey | GTUGXAPQBSJGJW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|