C25H46OS2 — CID 66617769
6-methyl-4,6-bis(octylsulfanylmethyl)cyclohexa-1,3-dien-1-ol (PubChem CID 66617769) has the molecular formula C25H46OS2 and a molecular weight of 426.78 g/mol. Its IUPAC name is 6-methyl-4,6-bis(octylsulfanylmethyl)cyclohexa-1,3-dien-1-ol.
| Compound Name | 6-methyl-4,6-bis(octylsulfanylmethyl)cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 66617769 |
| Molecular Formula | C25H46OS2 |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 6-methyl-4,6-bis(octylsulfanylmethyl)cyclohexa-1,3-dien-1-ol |
| SMILES | CCCCCCCCSCC1=CC=C(O)C(C)(CSCCCCCCCC)C1 |
| InChI | InChI=1S/C25H46OS2/c1-4-6-8-10-12-14-18-27-21-23-16-17-24(26)25(3,20-23)22-28-19-15-13-11-9-7-5-2/h16-17,26H,4-15,18-22H2,1-3H3 |
| InChIKey | UYQYTUYNNYZATF-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|