About 3-decyl-1,2-oxazole-5-carbaldehyde
3-decyl-1,2-oxazole-5-carbaldehyde (PubChem CID 18372911) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is 3-decyl-1,2-oxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 3-decyl-1,2-oxazole-5-carbaldehyde |
| PubChem CID | 18372911 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 3-decyl-1,2-oxazole-5-carbaldehyde |
| SMILES | CCCCCCCCCCc1cc(C=O)on1 |
| InChI | InChI=1S/C14H23NO2/c1-2-3-4-5-6-7-8-9-10-13-11-14(12-16)17-15-13/h11-12H,2-10H2,1H3 |
| InChIKey | QGYXSQWDFCPQHB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-decyl-1,2-oxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-decyl-1,2-oxazole-5-carbaldehyde?
The IUPAC name of 3-decyl-1,2-oxazole-5-carbaldehyde (CID 18372911) is 3-decyl-1,2-oxazole-5-carbaldehyde.
What is the SMILES notation for 3-decyl-1,2-oxazole-5-carbaldehyde?
The canonical SMILES for 3-decyl-1,2-oxazole-5-carbaldehyde is CCCCCCCCCCc1cc(C=O)on1.
What is the InChIKey of 3-decyl-1,2-oxazole-5-carbaldehyde?
The InChIKey is QGYXSQWDFCPQHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO2/c1-2-3-4-5-6-7-8-9-10-13-11-14(12-16)17-15-13/h11-12H,2-10H2,1H3.
What are the key properties of 3-decyl-1,2-oxazole-5-carbaldehyde?
3-decyl-1,2-oxazole-5-carbaldehyde has a molecular weight of 237.34 g/mol, XLogP of 4.17, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-decyl-1,2-oxazole-5-carbaldehyde is sourced from PubChem (CID 18372911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).