About 3-butoxy-1,2-oxazole-5-carbaldehyde
3-butoxy-1,2-oxazole-5-carbaldehyde (PubChem CID 87310525) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 3-butoxy-1,2-oxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 3-butoxy-1,2-oxazole-5-carbaldehyde |
| PubChem CID | 87310525 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 3-butoxy-1,2-oxazole-5-carbaldehyde |
| SMILES | CCCCOc1cc(C=O)on1 |
| InChI | InChI=1S/C8H11NO3/c1-2-3-4-11-8-5-7(6-10)12-9-8/h5-6H,2-4H2,1H3 |
| InChIKey | BQVHKNXMMTUZCC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-1,2-oxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-1,2-oxazole-5-carbaldehyde?
The IUPAC name of 3-butoxy-1,2-oxazole-5-carbaldehyde (CID 87310525) is 3-butoxy-1,2-oxazole-5-carbaldehyde.
What is the SMILES notation for 3-butoxy-1,2-oxazole-5-carbaldehyde?
The canonical SMILES for 3-butoxy-1,2-oxazole-5-carbaldehyde is CCCCOc1cc(C=O)on1.
What is the InChIKey of 3-butoxy-1,2-oxazole-5-carbaldehyde?
The InChIKey is BQVHKNXMMTUZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-2-3-4-11-8-5-7(6-10)12-9-8/h5-6H,2-4H2,1H3.
What are the key properties of 3-butoxy-1,2-oxazole-5-carbaldehyde?
3-butoxy-1,2-oxazole-5-carbaldehyde has a molecular weight of 169.18 g/mol, XLogP of 1.67, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-1,2-oxazole-5-carbaldehyde is sourced from PubChem (CID 87310525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).