C9H16NO3P — CID 86734614
1-(dimethoxyphosphorylmethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 86734614) has the molecular formula C9H16NO3P and a molecular weight of 217.21 g/mol. Its IUPAC name is 1-(dimethoxyphosphorylmethyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 1-(dimethoxyphosphorylmethyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 86734614 |
| Molecular Formula | C9H16NO3P |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1-(dimethoxyphosphorylmethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | COP(=O)(CC1(N)C=CC=CC1)OC |
| InChI | InChI=1S/C9H16NO3P/c1-12-14(11,13-2)8-9(10)6-4-3-5-7-9/h3-6H,7-8,10H2,1-2H3 |
| InChIKey | NZNBTBLFMXURSX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|