C8H11BO3 — CID 142702865
(1-acetylcyclohexa-2,4-dien-1-yl)boronic acid (PubChem CID 142702865) has the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. Its IUPAC name is (1-acetylcyclohexa-2,4-dien-1-yl)boronic acid.
| Compound Name | (1-acetylcyclohexa-2,4-dien-1-yl)boronic acid |
|---|---|
| PubChem CID | 142702865 |
| Molecular Formula | C8H11BO3 |
| Molecular Weight | 165.98 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (1-acetylcyclohexa-2,4-dien-1-yl)boronic acid |
| SMILES | CC(=O)C1(B(O)O)C=CC=CC1 |
| InChI | InChI=1S/C8H11BO3/c1-7(10)8(9(11)12)5-3-2-4-6-8/h2-5,11-12H,6H2,1H3 |
| InChIKey | JMOOQLHDQMSKRA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.98 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|