C10H12Br2 — CID 98624826
(1S,7S)-8,8-dibromo-1,7-dimethylbicyclo[5.1.0]octa-2,4-diene (PubChem CID 98624826) has the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. Its IUPAC name is (1S,7S)-8,8-dibromo-1,7-dimethylbicyclo[5.1.0]octa-2,4-diene.
| Compound Name | (1S,7S)-8,8-dibromo-1,7-dimethylbicyclo[5.1.0]octa-2,4-diene |
|---|---|
| PubChem CID | 98624826 |
| Molecular Formula | C10H12Br2 |
| Molecular Weight | 292.01 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | (1S,7S)-8,8-dibromo-1,7-dimethylbicyclo[5.1.0]octa-2,4-diene |
| SMILES | C[C@]12C=CC=CC[C@]1(C)C2(Br)Br |
| InChI | InChI=1S/C10H12Br2/c1-8-6-4-3-5-7-9(8,2)10(8,11)12/h3-6H,7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | NSLOLPLTKBXMJZ-IUCAKERBSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.01 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|