About 5-bromo-5-iodocyclohexa-1,3-diene;hydrate
5-bromo-5-iodocyclohexa-1,3-diene;hydrate (PubChem CID 172757994) has the molecular formula C6H8BrIO
and a molecular weight of 302.94 g/mol. Its IUPAC name is 5-bromo-5-iodocyclohexa-1,3-diene;hydrate.
Molecular Properties
| Compound Name | 5-bromo-5-iodocyclohexa-1,3-diene;hydrate |
| PubChem CID | 172757994 |
| Molecular Formula | C6H8BrIO |
| Molecular Weight | 302.94 g/mol |
| Exact Mass | 301.88 |
| IUPAC Name | 5-bromo-5-iodocyclohexa-1,3-diene;hydrate |
| SMILES | BrC1(I)C=CC=CC1.O |
| InChI | InChI=1S/C6H6BrI.H2O/c7-6(8)4-2-1-3-5-6;/h1-4H,5H2;1H2 |
| InChIKey | LHFIBPVIIOWRFO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.94 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-5-iodocyclohexa-1,3-diene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-5-iodocyclohexa-1,3-diene;hydrate?
The IUPAC name of 5-bromo-5-iodocyclohexa-1,3-diene;hydrate (CID 172757994) is 5-bromo-5-iodocyclohexa-1,3-diene;hydrate.
What is the SMILES notation for 5-bromo-5-iodocyclohexa-1,3-diene;hydrate?
The canonical SMILES for 5-bromo-5-iodocyclohexa-1,3-diene;hydrate is BrC1(I)C=CC=CC1.O.
What is the InChIKey of 5-bromo-5-iodocyclohexa-1,3-diene;hydrate?
The InChIKey is LHFIBPVIIOWRFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrI.H2O/c7-6(8)4-2-1-3-5-6;/h1-4H,5H2;1H2.
What are the key properties of 5-bromo-5-iodocyclohexa-1,3-diene;hydrate?
5-bromo-5-iodocyclohexa-1,3-diene;hydrate has a molecular weight of 302.94 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-5-iodocyclohexa-1,3-diene;hydrate is sourced from PubChem (CID 172757994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).