C6H9BrN2 — CID 171662498
(1-bromocyclohexa-2,4-dien-1-yl)hydrazine (PubChem CID 171662498) has the molecular formula C6H9BrN2 and a molecular weight of 189.06 g/mol. Its IUPAC name is (1-bromocyclohexa-2,4-dien-1-yl)hydrazine.
| Compound Name | (1-bromocyclohexa-2,4-dien-1-yl)hydrazine |
|---|---|
| PubChem CID | 171662498 |
| Molecular Formula | C6H9BrN2 |
| Molecular Weight | 189.06 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | (1-bromocyclohexa-2,4-dien-1-yl)hydrazine |
| SMILES | NNC1(Br)C=CC=CC1 |
| InChI | InChI=1S/C6H9BrN2/c7-6(9-8)4-2-1-3-5-6/h1-4,9H,5,8H2 |
| InChIKey | VCMAQXQXGGARGU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.06 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|