C7H10O2P+ — CID 155672201
hydroxy-[(1S)-1-methylcyclohexa-2,4-dien-1-yl]-oxophosphanium (PubChem CID 155672201) has the molecular formula C7H10O2P+ and a molecular weight of 157.13 g/mol. Its IUPAC name is hydroxy-[(1S)-1-methylcyclohexa-2,4-dien-1-yl]-oxophosphanium.
| Compound Name | hydroxy-[(1S)-1-methylcyclohexa-2,4-dien-1-yl]-oxophosphanium |
|---|---|
| PubChem CID | 155672201 |
| Molecular Formula | C7H10O2P+ |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | hydroxy-[(1S)-1-methylcyclohexa-2,4-dien-1-yl]-oxophosphanium |
| SMILES | C[C@@]1([P+](=O)O)C=CC=CC1 |
| InChI | InChI=1S/C7H9O2P/c1-7(10(8)9)5-3-2-4-6-7/h2-5H,6H2,1H3/p+1/t7-/m1/s1 |
| InChIKey | INFLNPCDXZLOGN-SSDOTTSWSA-O |
| XLogP | 2.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|