C8H9NO2 — CID 151519644
2-(1-aminocyclohexa-2,4-dien-1-yl)-2-oxoacetaldehyde (PubChem CID 151519644) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-(1-aminocyclohexa-2,4-dien-1-yl)-2-oxoacetaldehyde.
| Compound Name | 2-(1-aminocyclohexa-2,4-dien-1-yl)-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 151519644 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 2-(1-aminocyclohexa-2,4-dien-1-yl)-2-oxoacetaldehyde |
| SMILES | NC1(C(=O)C=O)C=CC=CC1 |
| InChI | InChI=1S/C8H9NO2/c9-8(7(11)6-10)4-2-1-3-5-8/h1-4,6H,5,9H2 |
| InChIKey | PUEZNIIDGALREZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|