C7H9N3O2 — CID 154197002
1-(aminodiazenyl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 154197002) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is 1-(aminodiazenyl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 1-(aminodiazenyl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 154197002 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 1-(aminodiazenyl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | N/N=N/C1(C(=O)O)C=CC=CC1 |
| InChI | InChI=1S/C7H9N3O2/c8-10-9-7(6(11)12)4-2-1-3-5-7/h1-4H,5H2,(H2,8,9)(H,11,12) |
| InChIKey | SSBMWDHKMFNFCB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|