C8H8N2OS — CID 142649289
1-isothiocyanatocyclohexa-2,4-diene-1-carboxamide (PubChem CID 142649289) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is 1-isothiocyanatocyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 1-isothiocyanatocyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 142649289 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 1-isothiocyanatocyclohexa-2,4-diene-1-carboxamide |
| SMILES | NC(=O)C1(N=C=S)C=CC=CC1 |
| InChI | InChI=1S/C8H8N2OS/c9-7(11)8(10-6-12)4-2-1-3-5-8/h1-4H,5H2,(H2,9,11) |
| InChIKey | CEWMOXAOPJYPAX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|