C8H6ClNO — CID 146635551
1-cyanocyclohexa-2,4-diene-1-carbonyl chloride (PubChem CID 146635551) has the molecular formula C8H6ClNO and a molecular weight of 167.59 g/mol. Its IUPAC name is 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride.
| Compound Name | 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride |
|---|---|
| PubChem CID | 146635551 |
| Molecular Formula | C8H6ClNO |
| Molecular Weight | 167.59 g/mol |
| Exact Mass | 167.01 |
| IUPAC Name | 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride |
| SMILES | N#CC1(C(=O)Cl)C=CC=CC1 |
| InChI | InChI=1S/C8H6ClNO/c9-7(11)8(6-10)4-2-1-3-5-8/h1-4H,5H2 |
| InChIKey | CUIAJYYBWPDEOO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|