About 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride
1-cyanocyclohexa-2,4-diene-1-carbonyl chloride (PubChem CID 146635551) has the molecular formula C8H6ClNO
and a molecular weight of 167.59 g/mol. Its IUPAC name is 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride.
Molecular Properties
| Compound Name | 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride |
| PubChem CID | 146635551 |
| Molecular Formula | C8H6ClNO |
| Molecular Weight | 167.59 g/mol |
| Exact Mass | 167.01 |
| IUPAC Name | 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride |
| SMILES | N#CC1(C(=O)Cl)C=CC=CC1 |
| InChI | InChI=1S/C8H6ClNO/c9-7(11)8(6-10)4-2-1-3-5-8/h1-4H,5H2 |
| InChIKey | CUIAJYYBWPDEOO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride?
The IUPAC name of 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride (CID 146635551) is 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride.
What is the SMILES notation for 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride?
The canonical SMILES for 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride is N#CC1(C(=O)Cl)C=CC=CC1.
What is the InChIKey of 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride?
The InChIKey is CUIAJYYBWPDEOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO/c9-7(11)8(6-10)4-2-1-3-5-8/h1-4H,5H2.
What are the key properties of 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride?
1-cyanocyclohexa-2,4-diene-1-carbonyl chloride has a molecular weight of 167.59 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanocyclohexa-2,4-diene-1-carbonyl chloride is sourced from PubChem (CID 146635551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).