C12H13N — CID 174494910
1-(1-ethenylcyclohexa-2,4-dien-1-yl)cyclopropane-1-carbonitrile (PubChem CID 174494910) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-(1-ethenylcyclohexa-2,4-dien-1-yl)cyclopropane-1-carbonitrile.
| Compound Name | 1-(1-ethenylcyclohexa-2,4-dien-1-yl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 174494910 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1-(1-ethenylcyclohexa-2,4-dien-1-yl)cyclopropane-1-carbonitrile |
| SMILES | C=CC1(C2(C#N)CC2)C=CC=CC1 |
| InChI | InChI=1S/C12H13N/c1-2-11(6-4-3-5-7-11)12(10-13)8-9-12/h2-6H,1,7-9H2 |
| InChIKey | MXMPDJIUMCHPQX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|