C8H8ClNO — CID 154217045
(2R)-2-(1-chlorocyclohexa-2,4-dien-1-yl)-2-hydroxyacetonitrile (PubChem CID 154217045) has the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. Its IUPAC name is (2R)-2-(1-chlorocyclohexa-2,4-dien-1-yl)-2-hydroxyacetonitrile.
| Compound Name | (2R)-2-(1-chlorocyclohexa-2,4-dien-1-yl)-2-hydroxyacetonitrile |
|---|---|
| PubChem CID | 154217045 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | (2R)-2-(1-chlorocyclohexa-2,4-dien-1-yl)-2-hydroxyacetonitrile |
| SMILES | N#C[C@@H](O)C1(Cl)C=CC=CC1 |
| InChI | InChI=1S/C8H8ClNO/c9-8(7(11)6-10)4-2-1-3-5-8/h1-4,7,11H,5H2/t7-,8?/m1/s1 |
| InChIKey | VJPHSCZMMDCYFA-GVHYBUMESA-N |
| XLogP | 1.36 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|