C9H11Cl — CID 150718617
5-chloro-5-prop-1-enylcyclohexa-1,3-diene (PubChem CID 150718617) has the molecular formula C9H11Cl and a molecular weight of 154.64 g/mol. Its IUPAC name is 5-chloro-5-prop-1-enylcyclohexa-1,3-diene.
| Compound Name | 5-chloro-5-prop-1-enylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 150718617 |
| Molecular Formula | C9H11Cl |
| Molecular Weight | 154.64 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 5-chloro-5-prop-1-enylcyclohexa-1,3-diene |
| SMILES | CC=CC1(Cl)C=CC=CC1 |
| InChI | InChI=1S/C9H11Cl/c1-2-6-9(10)7-4-3-5-8-9/h2-7H,8H2,1H3 |
| InChIKey | JPJWCGVPEVYGCU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|