C10H16O2 — CID 67785895
1-(1-hydroxy-2-methylpropyl)cyclohexa-2,4-dien-1-ol (PubChem CID 67785895) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(1-hydroxy-2-methylpropyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 1-(1-hydroxy-2-methylpropyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 67785895 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1-(1-hydroxy-2-methylpropyl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC(C)C(O)C1(O)C=CC=CC1 |
| InChI | InChI=1S/C10H16O2/c1-8(2)9(11)10(12)6-4-3-5-7-10/h3-6,8-9,11-12H,7H2,1-2H3 |
| InChIKey | OCQXDNNYHAXCNX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |