About (1-aminocyclohexa-2,4-dien-1-yl)urea
(1-aminocyclohexa-2,4-dien-1-yl)urea (PubChem CID 21247398) has the molecular formula C7H11N3O
and a molecular weight of 153.18 g/mol. Its IUPAC name is (1-aminocyclohexa-2,4-dien-1-yl)urea.
Molecular Properties
| Compound Name | (1-aminocyclohexa-2,4-dien-1-yl)urea |
| PubChem CID | 21247398 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | (1-aminocyclohexa-2,4-dien-1-yl)urea |
| SMILES | NC(=O)NC1(N)C=CC=CC1 |
| InChI | InChI=1S/C7H11N3O/c8-6(11)10-7(9)4-2-1-3-5-7/h1-4H,5,9H2,(H3,8,10,11) |
| InChIKey | IXZILDIHBJFSME-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-aminocyclohexa-2,4-dien-1-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-aminocyclohexa-2,4-dien-1-yl)urea?
The IUPAC name of (1-aminocyclohexa-2,4-dien-1-yl)urea (CID 21247398) is (1-aminocyclohexa-2,4-dien-1-yl)urea.
What is the SMILES notation for (1-aminocyclohexa-2,4-dien-1-yl)urea?
The canonical SMILES for (1-aminocyclohexa-2,4-dien-1-yl)urea is NC(=O)NC1(N)C=CC=CC1.
What is the InChIKey of (1-aminocyclohexa-2,4-dien-1-yl)urea?
The InChIKey is IXZILDIHBJFSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O/c8-6(11)10-7(9)4-2-1-3-5-7/h1-4H,5,9H2,(H3,8,10,11).
What are the key properties of (1-aminocyclohexa-2,4-dien-1-yl)urea?
(1-aminocyclohexa-2,4-dien-1-yl)urea has a molecular weight of 153.18 g/mol, XLogP of -0.17, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-aminocyclohexa-2,4-dien-1-yl)urea is sourced from PubChem (CID 21247398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).