C7H11N3O — CID 21247398
(1-aminocyclohexa-2,4-dien-1-yl)urea (PubChem CID 21247398) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is (1-aminocyclohexa-2,4-dien-1-yl)urea.
| Compound Name | (1-aminocyclohexa-2,4-dien-1-yl)urea |
|---|---|
| PubChem CID | 21247398 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | (1-aminocyclohexa-2,4-dien-1-yl)urea |
| SMILES | NC(=O)NC1(N)C=CC=CC1 |
| InChI | InChI=1S/C7H11N3O/c8-6(11)10-7(9)4-2-1-3-5-7/h1-4H,5,9H2,(H3,8,10,11) |
| InChIKey | IXZILDIHBJFSME-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|