C7H10N2O — CID 18187419
cyclohexa-2,4-dien-1-ylurea (PubChem CID 18187419) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-ylurea.
| Compound Name | cyclohexa-2,4-dien-1-ylurea |
|---|---|
| PubChem CID | 18187419 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | cyclohexa-2,4-dien-1-ylurea |
| SMILES | NC(=O)NC1C=CC=CC1 |
| InChI | InChI=1S/C7H10N2O/c8-7(10)9-6-4-2-1-3-5-6/h1-4,6H,5H2,(H3,8,9,10) |
| InChIKey | RDTJDICUGFHKTG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |