C9H13FN2O — CID 123389312
(6-fluoro-3-methylidenehepta-4,6-dien-2-yl)urea (PubChem CID 123389312) has the molecular formula C9H13FN2O and a molecular weight of 184.21 g/mol. Its IUPAC name is (6-fluoro-3-methylidenehepta-4,6-dien-2-yl)urea.
| Compound Name | (6-fluoro-3-methylidenehepta-4,6-dien-2-yl)urea |
|---|---|
| PubChem CID | 123389312 |
| Molecular Formula | C9H13FN2O |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (6-fluoro-3-methylidenehepta-4,6-dien-2-yl)urea |
| SMILES | C=C(F)C=CC(=C)C(C)NC(N)=O |
| InChI | InChI=1S/C9H13FN2O/c1-6(4-5-7(2)10)8(3)12-9(11)13/h4-5,8H,1-2H2,3H3,(H3,11,12,13) |
| InChIKey | RHPZWAPBKZPWCH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|