C9H15FN2O — CID 25052105
1-(2-Fluoroethyl)-3-(3-methylcyclopent-2-en-1-yl)urea (PubChem CID 25052105) has the molecular formula C9H15FN2O and a molecular weight of 186.23 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-(3-methylcyclopent-2-en-1-yl)urea.
| Compound Name | 1-(2-Fluoroethyl)-3-(3-methylcyclopent-2-en-1-yl)urea |
|---|---|
| PubChem CID | 25052105 |
| Molecular Formula | C9H15FN2O |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-(2-fluoroethyl)-3-(3-methylcyclopent-2-en-1-yl)urea |
| SMILES | CC1=CC(CC1)NC(=O)NCCF |
| InChI | InChI=1S/C9H15FN2O/c1-7-2-3-8(6-7)12-9(13)11-5-4-10/h6,8H,2-5H2,1H3,(H2,11,12,13) |
| InChIKey | HVHHGDZHFYVTER-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 41.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 216 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|