C11H19FN2O — CID 25052111
1-(3-ethylcyclohex-2-en-1-yl)-3-(2-fluoroethyl)urea (PubChem CID 25052111) has the molecular formula C11H19FN2O and a molecular weight of 214.28 g/mol. Its IUPAC name is 1-(3-ethylcyclohex-2-en-1-yl)-3-(2-fluoroethyl)urea.
| Compound Name | 1-(3-ethylcyclohex-2-en-1-yl)-3-(2-fluoroethyl)urea |
|---|---|
| PubChem CID | 25052111 |
| Molecular Formula | C11H19FN2O |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1-(3-ethylcyclohex-2-en-1-yl)-3-(2-fluoroethyl)urea |
| SMILES | CCC1=CC(NC(=O)NCCF)CCC1 |
| InChI | InChI=1S/C11H19FN2O/c1-2-9-4-3-5-10(8-9)14-11(15)13-7-6-12/h8,10H,2-7H2,1H3,(H2,13,14,15) |
| InChIKey | BUKSISPYPDMFMS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|