C17H29FN2O — CID 143584718
1-(1-cyclohexyl-2-phenylethyl)-3-(2-fluoroethyl)urea;molecular hydrogen (PubChem CID 143584718) has the molecular formula C17H29FN2O and a molecular weight of 296.43 g/mol. Its IUPAC name is 1-(1-cyclohexyl-2-phenylethyl)-3-(2-fluoroethyl)urea;molecular hydrogen.
| Compound Name | 1-(1-cyclohexyl-2-phenylethyl)-3-(2-fluoroethyl)urea;molecular hydrogen |
|---|---|
| PubChem CID | 143584718 |
| Molecular Formula | C17H29FN2O |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1-(1-cyclohexyl-2-phenylethyl)-3-(2-fluoroethyl)urea;molecular hydrogen |
| SMILES | O=C(NCCF)NC(Cc1ccccc1)C1CCCCC1.[H][H].[H][H] |
| InChI | InChI=1S/C17H25FN2O.2H2/c18-11-12-19-17(21)20-16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14;;/h1,3-4,7-8,15-16H,2,5-6,9-13H2,(H2,19,20,21);2*1H |
| InChIKey | PWLGHCQAHLGLJX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |