C17H30N2O — CID 118720728
1-cyclohexyl-3-[(2Z)-3,7-dimethylocta-2,6-dienyl]urea (PubChem CID 118720728) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2Z)-3,7-dimethylocta-2,6-dienyl]urea.
| Compound Name | 1-cyclohexyl-3-[(2Z)-3,7-dimethylocta-2,6-dienyl]urea |
|---|---|
| PubChem CID | 118720728 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 1-cyclohexyl-3-[(2Z)-3,7-dimethylocta-2,6-dienyl]urea |
| SMILES | CC(C)=CCC/C(C)=C\CNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H30N2O/c1-14(2)8-7-9-15(3)12-13-18-17(20)19-16-10-5-4-6-11-16/h8,12,16H,4-7,9-11,13H2,1-3H3,(H2,18,19,20)/b15-12- |
| InChIKey | BLANVSRTMZZAIG-QINSGFPZSA-N |
| XLogP | 4.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|