C13H23FN2O — CID 123404972
1-(4-ethyl-7-fluoroocta-4,6-dien-3-yl)-1,3-dimethylurea (PubChem CID 123404972) has the molecular formula C13H23FN2O and a molecular weight of 242.34 g/mol. Its IUPAC name is 1-(4-ethyl-7-fluoroocta-4,6-dien-3-yl)-1,3-dimethylurea.
| Compound Name | 1-(4-ethyl-7-fluoroocta-4,6-dien-3-yl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 123404972 |
| Molecular Formula | C13H23FN2O |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-(4-ethyl-7-fluoroocta-4,6-dien-3-yl)-1,3-dimethylurea |
| SMILES | CCC(=CC=C(C)F)C(CC)N(C)C(=O)NC |
| InChI | InChI=1S/C13H23FN2O/c1-6-11(9-8-10(3)14)12(7-2)16(5)13(17)15-4/h8-9,12H,6-7H2,1-5H3,(H,15,17) |
| InChIKey | RTDQPNZOCQQJCN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|