C10H13FN2O — CID 163975649
(6-fluoro-4-methylcyclohepta-1,3,5-trien-1-yl)methylurea (PubChem CID 163975649) has the molecular formula C10H13FN2O and a molecular weight of 196.22 g/mol. Its IUPAC name is (6-fluoro-4-methylcyclohepta-1,3,5-trien-1-yl)methylurea.
| Compound Name | (6-fluoro-4-methylcyclohepta-1,3,5-trien-1-yl)methylurea |
|---|---|
| PubChem CID | 163975649 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (6-fluoro-4-methylcyclohepta-1,3,5-trien-1-yl)methylurea |
| SMILES | CC1=CC=C(CNC(N)=O)CC(F)=C1 |
| InChI | InChI=1S/C10H13FN2O/c1-7-2-3-8(5-9(11)4-7)6-13-10(12)14/h2-4H,5-6H2,1H3,(H3,12,13,14) |
| InChIKey | STWJLMAQESKWJU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |