C9H10FNO — CID 143389094
N-[(5-fluorocyclohepta-1,3,5-trien-1-yl)methyl]formamide (PubChem CID 143389094) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is N-[(5-fluorocyclohepta-1,3,5-trien-1-yl)methyl]formamide.
| Compound Name | N-[(5-fluorocyclohepta-1,3,5-trien-1-yl)methyl]formamide |
|---|---|
| PubChem CID | 143389094 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | N-[(5-fluorocyclohepta-1,3,5-trien-1-yl)methyl]formamide |
| SMILES | O=CNCC1=CC=CC(F)=CC1 |
| InChI | InChI=1S/C9H10FNO/c10-9-3-1-2-8(4-5-9)6-11-7-12/h1-3,5,7H,4,6H2,(H,11,12) |
| InChIKey | ZNNGJRGXGQFAAM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|