C11H13FN2O — CID 146255078
N-[(2E,5Z)-6-(cyanomethyl)-2-fluoroocta-2,5,7-trienyl]formamide (PubChem CID 146255078) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is N-[(2E,5Z)-6-(cyanomethyl)-2-fluoroocta-2,5,7-trienyl]formamide.
| Compound Name | N-[(2E,5Z)-6-(cyanomethyl)-2-fluoroocta-2,5,7-trienyl]formamide |
|---|---|
| PubChem CID | 146255078 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-[(2E,5Z)-6-(cyanomethyl)-2-fluoroocta-2,5,7-trienyl]formamide |
| SMILES | C=C/C(=C\C/C=C(/F)CNC=O)CC#N |
| InChI | InChI=1S/C11H13FN2O/c1-2-10(6-7-13)4-3-5-11(12)8-14-9-15/h2,4-5,9H,1,3,6,8H2,(H,14,15)/b10-4+,11-5+ |
| InChIKey | AEPULJHMLSLVFY-ZVSIBQGLSA-N |
| XLogP | 2.00 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|