C8H9F2NO — CID 144877254
N-[(2,4-difluorocyclohexa-1,5-dien-1-yl)methyl]formamide (PubChem CID 144877254) has the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. Its IUPAC name is N-[(2,4-difluorocyclohexa-1,5-dien-1-yl)methyl]formamide.
| Compound Name | N-[(2,4-difluorocyclohexa-1,5-dien-1-yl)methyl]formamide |
|---|---|
| PubChem CID | 144877254 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | N-[(2,4-difluorocyclohexa-1,5-dien-1-yl)methyl]formamide |
| SMILES | O=CNCC1=C(F)CC(F)C=C1 |
| InChI | InChI=1S/C8H9F2NO/c9-7-2-1-6(4-11-5-12)8(10)3-7/h1-2,5,7H,3-4H2,(H,11,12) |
| InChIKey | UDDDQYGARAJWPU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|