C9H12N2O — CID 169197805
N-[(2E,4E)-4-cyano-2-methylhexa-2,4-dienyl]formamide (PubChem CID 169197805) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is N-[(2E,4E)-4-cyano-2-methylhexa-2,4-dienyl]formamide.
| Compound Name | N-[(2E,4E)-4-cyano-2-methylhexa-2,4-dienyl]formamide |
|---|---|
| PubChem CID | 169197805 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N-[(2E,4E)-4-cyano-2-methylhexa-2,4-dienyl]formamide |
| SMILES | C/C=C(C#N)\C=C(/C)CNC=O |
| InChI | InChI=1S/C9H12N2O/c1-3-9(5-10)4-8(2)6-11-7-12/h3-4,7H,6H2,1-2H3,(H,11,12)/b8-4+,9-3+ |
| InChIKey | BSARIAISTFGGRK-VBAIDPPHSA-N |
| XLogP | 1.15 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|