C10H15NO — CID 142251570
N-[(2E)-2-(2-methylprop-1-enyl)penta-2,4-dienyl]formamide (PubChem CID 142251570) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-[(2E)-2-(2-methylprop-1-enyl)penta-2,4-dienyl]formamide.
| Compound Name | N-[(2E)-2-(2-methylprop-1-enyl)penta-2,4-dienyl]formamide |
|---|---|
| PubChem CID | 142251570 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-[(2E)-2-(2-methylprop-1-enyl)penta-2,4-dienyl]formamide |
| SMILES | C=C/C=C(\C=C(C)C)CNC=O |
| InChI | InChI=1S/C10H15NO/c1-4-5-10(6-9(2)3)7-11-8-12/h4-6,8H,1,7H2,2-3H3,(H,11,12)/b10-5+ |
| InChIKey | BULDPOIBENEKKB-BJMVGYQFSA-N |
| XLogP | 1.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|