C9H11F2NO — CID 143428333
N-[(2Z,4E)-2-ethenyl-3,5-difluorohexa-2,4-dienyl]formamide (PubChem CID 143428333) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is N-[(2Z,4E)-2-ethenyl-3,5-difluorohexa-2,4-dienyl]formamide.
| Compound Name | N-[(2Z,4E)-2-ethenyl-3,5-difluorohexa-2,4-dienyl]formamide |
|---|---|
| PubChem CID | 143428333 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | N-[(2Z,4E)-2-ethenyl-3,5-difluorohexa-2,4-dienyl]formamide |
| SMILES | C=C/C(CNC=O)=C(F)\C=C(/C)F |
| InChI | InChI=1S/C9H11F2NO/c1-3-8(5-12-6-13)9(11)4-7(2)10/h3-4,6H,1,5H2,2H3,(H,12,13)/b7-4+,9-8- |
| InChIKey | GTERHNNTPBZTPF-KNOZVELGSA-N |
| XLogP | 2.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|