C8H10F3NO — CID 142104797
N-[(2E,4Z)-3-(trifluoromethyl)hexa-2,4-dienyl]formamide (PubChem CID 142104797) has the molecular formula C8H10F3NO and a molecular weight of 193.17 g/mol. Its IUPAC name is N-[(2E,4Z)-3-(trifluoromethyl)hexa-2,4-dienyl]formamide.
| Compound Name | N-[(2E,4Z)-3-(trifluoromethyl)hexa-2,4-dienyl]formamide |
|---|---|
| PubChem CID | 142104797 |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | N-[(2E,4Z)-3-(trifluoromethyl)hexa-2,4-dienyl]formamide |
| SMILES | C/C=C\C(=C/CNC=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO/c1-2-3-7(8(9,10)11)4-5-12-6-13/h2-4,6H,5H2,1H3,(H,12,13)/b3-2-,7-4+ |
| InChIKey | GRDWJOZMKPEMQW-UDJLOATDSA-N |
| XLogP | 1.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|