C9H10F5NO — CID 89214983
N-[(2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4-dienyl]formamide (PubChem CID 89214983) has the molecular formula C9H10F5NO and a molecular weight of 243.17 g/mol. Its IUPAC name is N-[(2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4-dienyl]formamide.
| Compound Name | N-[(2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4-dienyl]formamide |
|---|---|
| PubChem CID | 89214983 |
| Molecular Formula | C9H10F5NO |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-[(2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4-dienyl]formamide |
| SMILES | CC/C(F)=C(C(\F)=C/CNC=O)/C(F)(F)F |
| InChI | InChI=1S/C9H10F5NO/c1-2-6(10)8(9(12,13)14)7(11)3-4-15-5-16/h3,5H,2,4H2,1H3,(H,15,16)/b7-3+,8-6- |
| InChIKey | ZQOIQLNLKOTLGZ-OLDUDPGPSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|