C10H14FNO — CID 143562982
N-[(2Z,7E)-8-fluoro-6-methylocta-2,5,7-trien-4-yl]formamide (PubChem CID 143562982) has the molecular formula C10H14FNO and a molecular weight of 183.23 g/mol. Its IUPAC name is N-[(2Z,7E)-8-fluoro-6-methylocta-2,5,7-trien-4-yl]formamide.
| Compound Name | N-[(2Z,7E)-8-fluoro-6-methylocta-2,5,7-trien-4-yl]formamide |
|---|---|
| PubChem CID | 143562982 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | N-[(2Z,7E)-8-fluoro-6-methylocta-2,5,7-trien-4-yl]formamide |
| SMILES | C/C=C\C(C=C(C)/C=C/F)NC=O |
| InChI | InChI=1S/C10H14FNO/c1-3-4-10(12-8-13)7-9(2)5-6-11/h3-8,10H,1-2H3,(H,12,13)/b4-3-,6-5+,9-7? |
| InChIKey | UWLVNBQNZOOWQV-MESXMSJESA-N |
| XLogP | 2.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|