C10H12F3NO — CID 143836467
N-[(2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-dienyl]formamide (PubChem CID 143836467) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is N-[(2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-dienyl]formamide.
| Compound Name | N-[(2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-dienyl]formamide |
|---|---|
| PubChem CID | 143836467 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-[(2E,4E)-2-ethenyl-6,6,6-trifluoro-5-methylhexa-2,4-dienyl]formamide |
| SMILES | C=C/C(=C\C=C(/C)C(F)(F)F)CNC=O |
| InChI | InChI=1S/C10H12F3NO/c1-3-9(6-14-7-15)5-4-8(2)10(11,12)13/h3-5,7H,1,6H2,2H3,(H,14,15)/b8-4+,9-5+ |
| InChIKey | ALSLSXCEEHTGBA-KBXRYBNXSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|