C11H7F6NO — CID 142892441
N-[[3,6-bis(trifluoromethyl)cyclohepta-1,3,4,6-tetraen-1-yl]methyl]formamide (PubChem CID 142892441) has the molecular formula C11H7F6NO and a molecular weight of 283.17 g/mol. Its IUPAC name is N-[[3,6-bis(trifluoromethyl)cyclohepta-1,3,4,6-tetraen-1-yl]methyl]formamide.
| Compound Name | N-[[3,6-bis(trifluoromethyl)cyclohepta-1,3,4,6-tetraen-1-yl]methyl]formamide |
|---|---|
| PubChem CID | 142892441 |
| Molecular Formula | C11H7F6NO |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-[[3,6-bis(trifluoromethyl)cyclohepta-1,3,4,6-tetraen-1-yl]methyl]formamide |
| SMILES | O=CNCC1=CC(C(F)(F)F)=C=CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C11H7F6NO/c12-10(13,14)8-1-2-9(11(15,16)17)4-7(3-8)5-18-6-19/h1,3-4,6H,5H2,(H,18,19) |
| InChIKey | QHTUEQROIKHDMX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|